C7H6O7 — CID 21125848
(2S)-2-(carboxymethyl)-4-hydroxy-5-oxofuran-2-carboxylic acid (PubChem CID 21125848) has the molecular formula C7H6O7 and a molecular weight of 202.12 g/mol. Its IUPAC name is (2S)-2-(carboxymethyl)-4-hydroxy-5-oxofuran-2-carboxylic acid.
| Compound Name | (2S)-2-(carboxymethyl)-4-hydroxy-5-oxofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 21125848 |
| Molecular Formula | C7H6O7 |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | (2S)-2-(carboxymethyl)-4-hydroxy-5-oxofuran-2-carboxylic acid |
| SMILES | O=C(O)C[C@@]1(C(=O)O)C=C(O)C(=O)O1 |
| InChI | InChI=1S/C7H6O7/c8-3-1-7(6(12)13,2-4(9)10)14-5(3)11/h1,8H,2H2,(H,9,10)(H,12,13)/t7-/m1/s1 |
| InChIKey | WTMWQIVCMCKGPM-SSDOTTSWSA-N |
| XLogP | -0.72 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |