C8H6Cl2O4 — CID 14726964
2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid (PubChem CID 14726964) has the molecular formula C8H6Cl2O4 and a molecular weight of 237.04 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid.
| Compound Name | 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 14726964 |
| Molecular Formula | C8H6Cl2O4 |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid |
| SMILES | O=C(O)CC1(O)C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C8H6Cl2O4/c9-4-1-8(14,3-6(11)12)2-5(10)7(4)13/h1-2,14H,3H2,(H,11,12) |
| InChIKey | QFTJWFCSDCGBEH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|