C8H4Cl4O4 — CID 23031684
2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid (PubChem CID 23031684) has the molecular formula C8H4Cl4O4 and a molecular weight of 305.93 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid.
| Compound Name | 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 23031684 |
| Molecular Formula | C8H4Cl4O4 |
| Molecular Weight | 305.93 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetic acid |
| SMILES | O=C(O)CC1(O)C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H4Cl4O4/c9-3-5(15)4(10)7(12)8(16,6(3)11)1-2(13)14/h16H,1H2,(H,13,14) |
| InChIKey | MHYSLYZYYXWAGI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|