C8H5Cl2O4- — CID 23031682
2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (PubChem CID 23031682) has the molecular formula C8H5Cl2O4- and a molecular weight of 236.03 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
| Compound Name | 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
|---|---|
| PubChem CID | 23031682 |
| Molecular Formula | C8H5Cl2O4- |
| Molecular Weight | 236.03 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| SMILES | O=C([O-])CC1(O)C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C8H6Cl2O4/c9-4-1-8(14,3-6(11)12)2-5(10)7(4)13/h1-2,14H,3H2,(H,11,12)/p-1 |
| InChIKey | QFTJWFCSDCGBEH-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.03 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|