C12H22O7 — CID 21133607
2,5-dihydroperoxy-3,4-dimethyl-6-prop-1-en-2-yloxyheptanoic acid (PubChem CID 21133607) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2,5-dihydroperoxy-3,4-dimethyl-6-prop-1-en-2-yloxyheptanoic acid.
| Compound Name | 2,5-dihydroperoxy-3,4-dimethyl-6-prop-1-en-2-yloxyheptanoic acid |
|---|---|
| PubChem CID | 21133607 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2,5-dihydroperoxy-3,4-dimethyl-6-prop-1-en-2-yloxyheptanoic acid |
| SMILES | C=C(C)OC(C)C(OO)C(C)C(C)C(OO)C(=O)O |
| InChI | InChI=1S/C12H22O7/c1-6(2)17-9(5)10(18-15)7(3)8(4)11(19-16)12(13)14/h7-11,15-16H,1H2,2-5H3,(H,13,14) |
| InChIKey | GGWNXMYXRLVIQS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|