C23H20FNO3S — CID 21133756
2-[[2-(4-fluorophenyl)-4-methyl-1,3-benzothiazol-5-yl]-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 21133756) has the molecular formula C23H20FNO3S and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-4-methyl-1,3-benzothiazol-5-yl]-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[[2-(4-fluorophenyl)-4-methyl-1,3-benzothiazol-5-yl]-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 21133756 |
| Molecular Formula | C23H20FNO3S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-4-methyl-1,3-benzothiazol-5-yl]-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | Cc1c(C(O)=C2C(=O)CC(C)(C)CC2=O)ccc2sc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C23H20FNO3S/c1-12-15(21(28)19-16(26)10-23(2,3)11-17(19)27)8-9-18-20(12)25-22(29-18)13-4-6-14(24)7-5-13/h4-9,28H,10-11H2,1-3H3 |
| InChIKey | HJWCUVNPQSJGBB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|