C8H14N2O2 — CID 21139520
trans-(1S,2S)-cyclohexane-1,2-dicarboxamide (PubChem CID 21139520) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is trans-(1S,2S)-cyclohexane-1,2-dicarboxamide.
| Compound Name | trans-(1S,2S)-cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 21139520 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | trans-(1S,2S)-cyclohexane-1,2-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C8H14N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h5-6H,1-4H2,(H2,9,11)(H2,10,12)/t5-,6-/m0/s1 |
| InChIKey | LGFUGDIGUMLNBI-WDSKDSINSA-N |
| XLogP | -0.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |