About 3-cyclohexylpropanamide
3-cyclohexylpropanamide (PubChem CID 551691) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 3-cyclohexylpropanamide.
Molecular Properties
| Compound Name | 3-cyclohexylpropanamide |
| PubChem CID | 551691 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 3-cyclohexylpropanamide |
| SMILES | NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C9H17NO/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11) |
| InChIKey | FMNWPBFQLPJWAM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpropanamide?
The IUPAC name of 3-cyclohexylpropanamide (CID 551691) is 3-cyclohexylpropanamide.
What is the SMILES notation for 3-cyclohexylpropanamide?
The canonical SMILES for 3-cyclohexylpropanamide is NC(=O)CCC1CCCCC1.
What is the InChIKey of 3-cyclohexylpropanamide?
The InChIKey is FMNWPBFQLPJWAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H2,10,11).
What are the key properties of 3-cyclohexylpropanamide?
3-cyclohexylpropanamide has a molecular weight of 155.24 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpropanamide is sourced from PubChem (CID 551691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).