About (4S)-4,5-dihydroxy-2-oxopentanal
(4S)-4,5-dihydroxy-2-oxopentanal (PubChem CID 21140178) has the molecular formula C5H8O4
and a molecular weight of 132.12 g/mol. Its IUPAC name is (4S)-4,5-dihydroxy-2-oxopentanal.
Molecular Properties
| Compound Name | (4S)-4,5-dihydroxy-2-oxopentanal |
| PubChem CID | 21140178 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (4S)-4,5-dihydroxy-2-oxopentanal |
| SMILES | O=CC(=O)C[C@H](O)CO |
| InChI | InChI=1S/C5H8O4/c6-2-4(8)1-5(9)3-7/h2,5,7,9H,1,3H2/t5-/m0/s1 |
| InChIKey | QFNWRVAZZYFNCF-YFKPBYRVSA-N |
| XLogP | -1.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4,5-dihydroxy-2-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,5-dihydroxy-2-oxopentanal?
The IUPAC name of (4S)-4,5-dihydroxy-2-oxopentanal (CID 21140178) is (4S)-4,5-dihydroxy-2-oxopentanal.
What is the SMILES notation for (4S)-4,5-dihydroxy-2-oxopentanal?
The canonical SMILES for (4S)-4,5-dihydroxy-2-oxopentanal is O=CC(=O)C[C@H](O)CO.
What is the InChIKey of (4S)-4,5-dihydroxy-2-oxopentanal?
The InChIKey is QFNWRVAZZYFNCF-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H8O4/c6-2-4(8)1-5(9)3-7/h2,5,7,9H,1,3H2/t5-/m0/s1.
What are the key properties of (4S)-4,5-dihydroxy-2-oxopentanal?
(4S)-4,5-dihydroxy-2-oxopentanal has a molecular weight of 132.12 g/mol, XLogP of -1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,5-dihydroxy-2-oxopentanal is sourced from PubChem (CID 21140178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).