C14H11N2O2+ — CID 21140200
1-oxo-2,4-diphenyldiazetidin-1-ium-3-one (PubChem CID 21140200) has the molecular formula C14H11N2O2+ and a molecular weight of 239.25 g/mol. Its IUPAC name is 1-oxo-2,4-diphenyldiazetidin-1-ium-3-one.
| Compound Name | 1-oxo-2,4-diphenyldiazetidin-1-ium-3-one |
|---|---|
| PubChem CID | 21140200 |
| Molecular Formula | C14H11N2O2+ |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-oxo-2,4-diphenyldiazetidin-1-ium-3-one |
| SMILES | O=C1C(c2ccccc2)[N+](=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H11N2O2/c17-14-13(11-7-3-1-4-8-11)16(18)15(14)12-9-5-2-6-10-12/h1-10,13H/q+1 |
| InChIKey | FTZJHPCCPOSQII-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|