C15H16N3O4- — CID 21141433
1-[8-[hydroxy(oxido)amino]-7-methoxy-1-methylidene-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl]ethanone (PubChem CID 21141433) has the molecular formula C15H16N3O4- and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-[8-[hydroxy(oxido)amino]-7-methoxy-1-methylidene-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl]ethanone.
| Compound Name | 1-[8-[hydroxy(oxido)amino]-7-methoxy-1-methylidene-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 21141433 |
| Molecular Formula | C15H16N3O4- |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[8-[hydroxy(oxido)amino]-7-methoxy-1-methylidene-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl]ethanone |
| SMILES | C=C1c2[nH]c3c(N([O-])O)c(OC)ccc3c2CCN1C(C)=O |
| InChI | InChI=1S/C15H16N3O4/c1-8-13-11(6-7-17(8)9(2)19)10-4-5-12(22-3)15(18(20)21)14(10)16-13/h4-5,16,20H,1,6-7H2,2-3H3/q-1 |
| InChIKey | DJJLHWLNXYBPKA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|