C18H20N4O2 — CID 14468467
1-(6-amino-5-methoxy-9-methyl-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)ethanone (PubChem CID 14468467) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(6-amino-5-methoxy-9-methyl-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)ethanone.
| Compound Name | 1-(6-amino-5-methoxy-9-methyl-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)ethanone |
|---|---|
| PubChem CID | 14468467 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(6-amino-5-methoxy-9-methyl-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)ethanone |
| SMILES | COc1ccc2c(nc(C)c3c4c([nH]c32)CCN(C(C)=O)C4)c1N |
| InChI | InChI=1S/C18H20N4O2/c1-9-15-12-8-22(10(2)23)7-6-13(12)21-17(15)11-4-5-14(24-3)16(19)18(11)20-9/h4-5,21H,6-8,19H2,1-3H3 |
| InChIKey | HPIXCTAYHFHRJH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|