C18H24N6O6 — CID 21143404
4-[2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-1,3-dihydroxypropyl]-N-hydroxybenzeneamine oxide (PubChem CID 21143404) has the molecular formula C18H24N6O6 and a molecular weight of 420.43 g/mol. Its IUPAC name is 4-[2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-1,3-dihydroxypropyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-1,3-dihydroxypropyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 21143404 |
| Molecular Formula | C18H24N6O6 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylamino]-1,3-dihydroxypropyl]-N-hydroxybenzeneamine oxide |
| SMILES | Cn1c(=O)c2c(ncn2CCNC(CO)C(O)c2ccc([NH+]([O-])O)cc2)n(C)c1=O |
| InChI | InChI=1S/C18H24N6O6/c1-21-16-14(17(27)22(2)18(21)28)23(10-20-16)8-7-19-13(9-25)15(26)11-3-5-12(6-4-11)24(29)30/h3-6,10,13,15,19,24-26,29H,7-9H2,1-2H3 |
| InChIKey | FLCHADXUCCSPLN-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 162.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|