C20H32N2O8S4 — CID 21150790
N,N'-bis[(9-hydroxy-4,7-dioxononyl)disulfanyl]oxamide (PubChem CID 21150790) has the molecular formula C20H32N2O8S4 and a molecular weight of 556.75 g/mol. Its IUPAC name is N,N'-bis[(9-hydroxy-4,7-dioxononyl)disulfanyl]oxamide.
| Compound Name | N,N'-bis[(9-hydroxy-4,7-dioxononyl)disulfanyl]oxamide |
|---|---|
| PubChem CID | 21150790 |
| Molecular Formula | C20H32N2O8S4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | N,N'-bis[(9-hydroxy-4,7-dioxononyl)disulfanyl]oxamide |
| SMILES | O=C(CCO)CCC(=O)CCCSSNC(=O)C(=O)NSSCCCC(=O)CCC(=O)CCO |
| InChI | InChI=1S/C20H32N2O8S4/c23-11-9-17(27)7-5-15(25)3-1-13-31-33-21-19(29)20(30)22-34-32-14-2-4-16(26)6-8-18(28)10-12-24/h23-24H,1-14H2,(H,21,29)(H,22,30) |
| InChIKey | BNFWRJFRDBAQET-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|