C28H28Cl2N3O7+ — CID 21153639
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-[4-chloro-2-(2-chlorobenzoyl)phenyl]-methyl-(2-phenylethyl)azanium;oxalic acid (PubChem CID 21153639) has the molecular formula C28H28Cl2N3O7+ and a molecular weight of 589.45 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-[4-chloro-2-(2-chlorobenzoyl)phenyl]-methyl-(2-phenylethyl)azanium;oxalic acid.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-[4-chloro-2-(2-chlorobenzoyl)phenyl]-methyl-(2-phenylethyl)azanium;oxalic acid |
|---|---|
| PubChem CID | 21153639 |
| Molecular Formula | C28H28Cl2N3O7+ |
| Molecular Weight | 589.45 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-[4-chloro-2-(2-chlorobenzoyl)phenyl]-methyl-(2-phenylethyl)azanium;oxalic acid |
| SMILES | C[N+](CCc1ccccc1)(CC(=O)NCC(N)=O)c1ccc(Cl)cc1C(=O)c1ccccc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H25Cl2N3O3.C2H2O4/c1-31(17-25(33)30-16-24(29)32,14-13-18-7-3-2-4-8-18)23-12-11-19(27)15-21(23)26(34)20-9-5-6-10-22(20)28;3-1(4)2(5)6/h2-12,15H,13-14,16-17H2,1H3,(H2-,29,30,32,33);(H,3,4)(H,5,6)/p+1 |
| InChIKey | YHYLMWNJUSXOFD-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|