C21H17ClN4O2S — CID 21154618
1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)sulfanylurea (PubChem CID 21154618) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)sulfanylurea.
| Compound Name | 1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)sulfanylurea |
|---|---|
| PubChem CID | 21154618 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(4-chlorophenyl)sulfanylurea |
| SMILES | O=C(NSc1ccc(Cl)cc1)Nc1ccc(OCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C21H17ClN4O2S/c22-14-5-11-17(12-6-14)29-26-21(27)23-15-7-9-16(10-8-15)28-13-20-24-18-3-1-2-4-19(18)25-20/h1-12H,13H2,(H,24,25)(H2,23,26,27) |
| InChIKey | IRNYWGOYFCYYQT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|