C22H18Cl2N4OS — CID 134465955
1-[4-(1H-benzimidazol-2-ylmethoxy)-2-methylphenyl]-3-(3,4-dichlorophenyl)thiourea (PubChem CID 134465955) has the molecular formula C22H18Cl2N4OS and a molecular weight of 457.39 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-ylmethoxy)-2-methylphenyl]-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[4-(1H-benzimidazol-2-ylmethoxy)-2-methylphenyl]-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 134465955 |
| Molecular Formula | C22H18Cl2N4OS |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-ylmethoxy)-2-methylphenyl]-3-(3,4-dichlorophenyl)thiourea |
| SMILES | Cc1cc(OCc2nc3ccccc3[nH]2)ccc1NC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N4OS/c1-13-10-15(29-12-21-26-19-4-2-3-5-20(19)27-21)7-9-18(13)28-22(30)25-14-6-8-16(23)17(24)11-14/h2-11H,12H2,1H3,(H,26,27)(H2,25,28,30) |
| InChIKey | AXVHYPCEGHHNFT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|