C27H22N4O2S — CID 21154631
1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(2-phenylphenyl)sulfanylurea (PubChem CID 21154631) has the molecular formula C27H22N4O2S and a molecular weight of 466.57 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(2-phenylphenyl)sulfanylurea.
| Compound Name | 1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(2-phenylphenyl)sulfanylurea |
|---|---|
| PubChem CID | 21154631 |
| Molecular Formula | C27H22N4O2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-3-(2-phenylphenyl)sulfanylurea |
| SMILES | O=C(NSc1ccccc1-c1ccccc1)Nc1ccc(OCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H22N4O2S/c32-27(31-34-25-13-7-4-10-22(25)19-8-2-1-3-9-19)28-20-14-16-21(17-15-20)33-18-26-29-23-11-5-6-12-24(23)30-26/h1-17H,18H2,(H,29,30)(H2,28,31,32) |
| InChIKey | HRHALBZJGDYBGZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|