C20H17N5O2 — CID 21157381
2,3-dianilino-N-hydroxyquinoxalin-6-amine oxide (PubChem CID 21157381) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2,3-dianilino-N-hydroxyquinoxalin-6-amine oxide.
| Compound Name | 2,3-dianilino-N-hydroxyquinoxalin-6-amine oxide |
|---|---|
| PubChem CID | 21157381 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2,3-dianilino-N-hydroxyquinoxalin-6-amine oxide |
| SMILES | [O-][NH+](O)c1ccc2nc(Nc3ccccc3)c(Nc3ccccc3)nc2c1 |
| InChI | InChI=1S/C20H17N5O2/c26-25(27)16-11-12-17-18(13-16)24-20(22-15-9-5-2-6-10-15)19(23-17)21-14-7-3-1-4-8-14/h1-13,25-26H,(H,21,23)(H,22,24) |
| InChIKey | ZYPGYPAGFHMRJW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|