C23H25N7O4S — CID 21157256
9-[4-[3-(diaminomethylideneamino)propylsulfonylamino]anilino]-N-hydroxyacridin-3-amine oxide (PubChem CID 21157256) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is 9-[4-[3-(diaminomethylideneamino)propylsulfonylamino]anilino]-N-hydroxyacridin-3-amine oxide.
| Compound Name | 9-[4-[3-(diaminomethylideneamino)propylsulfonylamino]anilino]-N-hydroxyacridin-3-amine oxide |
|---|---|
| PubChem CID | 21157256 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 9-[4-[3-(diaminomethylideneamino)propylsulfonylamino]anilino]-N-hydroxyacridin-3-amine oxide |
| SMILES | NC(N)=NCCCS(=O)(=O)Nc1ccc(Nc2c3ccccc3nc3cc([NH+]([O-])O)ccc23)cc1 |
| InChI | InChI=1S/C23H25N7O4S/c24-23(25)26-12-3-13-35(33,34)29-16-8-6-15(7-9-16)27-22-18-4-1-2-5-20(18)28-21-14-17(30(31)32)10-11-19(21)22/h1-2,4-11,14,29-31H,3,12-13H2,(H,27,28)(H4,24,25,26) |
| InChIKey | HOCGPRASYZMFRC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 183.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|