C22H20N4O6S — CID 21143747
9-[4-(acetylsulfamoyl)anilino]-N-hydroxy-5-methoxyacridin-3-amine oxide (PubChem CID 21143747) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is 9-[4-(acetylsulfamoyl)anilino]-N-hydroxy-5-methoxyacridin-3-amine oxide.
| Compound Name | 9-[4-(acetylsulfamoyl)anilino]-N-hydroxy-5-methoxyacridin-3-amine oxide |
|---|---|
| PubChem CID | 21143747 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 9-[4-(acetylsulfamoyl)anilino]-N-hydroxy-5-methoxyacridin-3-amine oxide |
| SMILES | COc1cccc2c(Nc3ccc(S(=O)(=O)NC(C)=O)cc3)c3ccc([NH+]([O-])O)cc3nc12 |
| InChI | InChI=1S/C22H20N4O6S/c1-13(27)25-33(30,31)16-9-6-14(7-10-16)23-21-17-11-8-15(26(28)29)12-19(17)24-22-18(21)4-3-5-20(22)32-2/h3-12,26,28H,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | JQSCFDMAXHLYRU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|