C23H23BrN4O3S — CID 90675353
N-[4-[(3-aminoacridin-9-yl)amino]phenyl]-N-methylsulfonylpropanamide;hydrobromide (PubChem CID 90675353) has the molecular formula C23H23BrN4O3S and a molecular weight of 515.43 g/mol. Its IUPAC name is N-[4-[(3-aminoacridin-9-yl)amino]phenyl]-N-methylsulfonylpropanamide;hydrobromide.
| Compound Name | N-[4-[(3-aminoacridin-9-yl)amino]phenyl]-N-methylsulfonylpropanamide;hydrobromide |
|---|---|
| PubChem CID | 90675353 |
| Molecular Formula | C23H23BrN4O3S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | N-[4-[(3-aminoacridin-9-yl)amino]phenyl]-N-methylsulfonylpropanamide;hydrobromide |
| SMILES | Br.CCC(=O)N(c1ccc(Nc2c3ccccc3nc3cc(N)ccc23)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H22N4O3S.BrH/c1-3-22(28)27(31(2,29)30)17-11-9-16(10-12-17)25-23-18-6-4-5-7-20(18)26-21-14-15(24)8-13-19(21)23;/h4-14H,3,24H2,1-2H3,(H,25,26);1H |
| InChIKey | CDDQOSRGSSBXQF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|