C27H29ClN4O4S — CID 90675348
N-[4-[(3-acetamidoacridin-9-yl)amino]phenyl]-2-methyl-N-methylsulfonylbutanamide;hydrochloride (PubChem CID 90675348) has the molecular formula C27H29ClN4O4S and a molecular weight of 541.07 g/mol. Its IUPAC name is N-[4-[(3-acetamidoacridin-9-yl)amino]phenyl]-2-methyl-N-methylsulfonylbutanamide;hydrochloride.
| Compound Name | N-[4-[(3-acetamidoacridin-9-yl)amino]phenyl]-2-methyl-N-methylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 90675348 |
| Molecular Formula | C27H29ClN4O4S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[4-[(3-acetamidoacridin-9-yl)amino]phenyl]-2-methyl-N-methylsulfonylbutanamide;hydrochloride |
| SMILES | CCC(C)C(=O)N(c1ccc(Nc2c3ccccc3nc3cc(NC(C)=O)ccc23)cc1)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C27H28N4O4S.ClH/c1-5-17(2)27(33)31(36(4,34)35)21-13-10-19(11-14-21)29-26-22-8-6-7-9-24(22)30-25-16-20(28-18(3)32)12-15-23(25)26;/h6-17H,5H2,1-4H3,(H,28,32)(H,29,30);1H |
| InChIKey | UZVMRIFAQSTGSD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|