C35H48O3S — CID 21159780
[(10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 21159780) has the molecular formula C35H48O3S and a molecular weight of 548.83 g/mol. Its IUPAC name is [(10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21159780 |
| Molecular Formula | C35H48O3S |
| Molecular Weight | 548.83 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | [(10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CC[C@@]3(C)C(=CC=C4C3=CC[C@]3(C)[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C35H48O3S/c1-23(2)25(4)10-11-26(5)31-16-17-32-30-15-12-27-22-28(38-39(36,37)29-13-8-24(3)9-14-29)18-20-34(27,6)33(30)19-21-35(31,32)7/h8-15,19,23,25-26,28,31-32H,16-18,20-22H2,1-7H3/b11-10+/t25-,26+,28?,31+,32-,34-,35+/m0/s1 |
| InChIKey | VXXITKCTUSZFGT-QYPMRYJHSA-N |
| XLogP | 8.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.83 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|