C25H25IN2O2S2 — CID 21176431
N,N-dimethyl-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(4-methylphenyl)sulfonylethenyl]aniline iodide (PubChem CID 21176431) has the molecular formula C25H25IN2O2S2 and a molecular weight of 576.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(4-methylphenyl)sulfonylethenyl]aniline iodide.
| Compound Name | N,N-dimethyl-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(4-methylphenyl)sulfonylethenyl]aniline iodide |
|---|---|
| PubChem CID | 21176431 |
| Molecular Formula | C25H25IN2O2S2 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | N,N-dimethyl-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-2-(4-methylphenyl)sulfonylethenyl]aniline iodide |
| SMILES | Cc1ccc(S(=O)(=O)C(=Cc2ccc(N(C)C)cc2)c2sc3ccccc3[n+]2C)cc1.[I-] |
| InChI | InChI=1S/C25H25N2O2S2.HI/c1-18-9-15-21(16-10-18)31(28,29)24(17-19-11-13-20(14-12-19)26(2)3)25-27(4)22-7-5-6-8-23(22)30-25;/h5-17H,1-4H3;1H/q+1;/p-1 |
| InChIKey | CWTDATWRPOHYOI-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|