C22H18ClN2O2S- — CID 21179266
N-(4-hydroxy-2,4-diphenyl-5H-1,3-thiazol-5-yl)benzamide chloride (PubChem CID 21179266) has the molecular formula C22H18ClN2O2S- and a molecular weight of 409.92 g/mol. Its IUPAC name is N-(4-hydroxy-2,4-diphenyl-5H-1,3-thiazol-5-yl)benzamide chloride.
| Compound Name | N-(4-hydroxy-2,4-diphenyl-5H-1,3-thiazol-5-yl)benzamide chloride |
|---|---|
| PubChem CID | 21179266 |
| Molecular Formula | C22H18ClN2O2S- |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-(4-hydroxy-2,4-diphenyl-5H-1,3-thiazol-5-yl)benzamide chloride |
| SMILES | O=C(NC1SC(c2ccccc2)=NC1(O)c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H18N2O2S.ClH/c25-19(16-10-4-1-5-11-16)23-21-22(26,18-14-8-3-9-15-18)24-20(27-21)17-12-6-2-7-13-17;/h1-15,21,26H,(H,23,25);1H/p-1 |
| InChIKey | NRTKRNMVXQXEAF-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |