C11H12N4O — CID 173153156
N-(5-amino-1,2-dihydropyrimidin-2-yl)benzamide (PubChem CID 173153156) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is N-(5-amino-1,2-dihydropyrimidin-2-yl)benzamide.
| Compound Name | N-(5-amino-1,2-dihydropyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 173153156 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | N-(5-amino-1,2-dihydropyrimidin-2-yl)benzamide |
| SMILES | NC1=CNC(NC(=O)c2ccccc2)N=C1 |
| InChI | InChI=1S/C11H12N4O/c12-9-6-13-11(14-7-9)15-10(16)8-4-2-1-3-5-8/h1-7,11,13H,12H2,(H,15,16) |
| InChIKey | VHPPQHUKZWYWGQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |