C13H12Cl3NO3S — CID 21179846
2,2,2-trichloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(2-methylphenyl)acetamide (PubChem CID 21179846) has the molecular formula C13H12Cl3NO3S and a molecular weight of 368.67 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 21179846 |
| Molecular Formula | C13H12Cl3NO3S |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 2,2,2-trichloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1N(C(=O)C(Cl)(Cl)Cl)C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H12Cl3NO3S/c1-9-4-2-3-5-11(9)17(12(18)13(14,15)16)10-6-7-21(19,20)8-10/h2-7,10H,8H2,1H3 |
| InChIKey | CLEQROHIKJJXIY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|