C15H14Cl3NO5S — CID 21179857
ethyl 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)-(2,2,2-trichloroacetyl)amino]benzoate (PubChem CID 21179857) has the molecular formula C15H14Cl3NO5S and a molecular weight of 426.71 g/mol. Its IUPAC name is ethyl 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)-(2,2,2-trichloroacetyl)amino]benzoate.
| Compound Name | ethyl 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)-(2,2,2-trichloroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 21179857 |
| Molecular Formula | C15H14Cl3NO5S |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | ethyl 3-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)-(2,2,2-trichloroacetyl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(N(C(=O)C(Cl)(Cl)Cl)C2C=CS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H14Cl3NO5S/c1-2-24-13(20)10-4-3-5-11(8-10)19(14(21)15(16,17)18)12-6-7-25(22,23)9-12/h3-8,12H,2,9H2,1H3 |
| InChIKey | BGZXLABBJCYMTN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|