C24H32FN2+ — CID 21181474
benzyl-[4-cyano-4-(2-fluorophenyl)-5-methylhexyl]-ethyl-methylazanium (PubChem CID 21181474) has the molecular formula C24H32FN2+ and a molecular weight of 367.53 g/mol. Its IUPAC name is benzyl-[4-cyano-4-(2-fluorophenyl)-5-methylhexyl]-ethyl-methylazanium.
| Compound Name | benzyl-[4-cyano-4-(2-fluorophenyl)-5-methylhexyl]-ethyl-methylazanium |
|---|---|
| PubChem CID | 21181474 |
| Molecular Formula | C24H32FN2+ |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | benzyl-[4-cyano-4-(2-fluorophenyl)-5-methylhexyl]-ethyl-methylazanium |
| SMILES | CC[N+](C)(CCCC(C#N)(c1ccccc1F)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C24H32FN2/c1-5-27(4,18-21-12-7-6-8-13-21)17-11-16-24(19-26,20(2)3)22-14-9-10-15-23(22)25/h6-10,12-15,20H,5,11,16-18H2,1-4H3/q+1 |
| InChIKey | WLWXXTWIYPZQHA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|