C21H20O7 — CID 21189077
[2-(2,4-diacetyloxyphenyl)oxiran-2-yl]methyl 2-phenylacetate (PubChem CID 21189077) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is [2-(2,4-diacetyloxyphenyl)oxiran-2-yl]methyl 2-phenylacetate.
| Compound Name | [2-(2,4-diacetyloxyphenyl)oxiran-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 21189077 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [2-(2,4-diacetyloxyphenyl)oxiran-2-yl]methyl 2-phenylacetate |
| SMILES | CC(=O)Oc1ccc(C2(COC(=O)Cc3ccccc3)CO2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C21H20O7/c1-14(22)27-17-8-9-18(19(11-17)28-15(2)23)21(13-26-21)12-25-20(24)10-16-6-4-3-5-7-16/h3-9,11H,10,12-13H2,1-2H3 |
| InChIKey | DCOIGUFAERSWDX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|