C30H24O5 — CID 70562525
(7-acetyloxy-8-methyl-9,9-diphenylxanthen-3-yl) acetate (PubChem CID 70562525) has the molecular formula C30H24O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (7-acetyloxy-8-methyl-9,9-diphenylxanthen-3-yl) acetate.
| Compound Name | (7-acetyloxy-8-methyl-9,9-diphenylxanthen-3-yl) acetate |
|---|---|
| PubChem CID | 70562525 |
| Molecular Formula | C30H24O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (7-acetyloxy-8-methyl-9,9-diphenylxanthen-3-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1ccc(OC(C)=O)c(C)c1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24O5/c1-19-26(34-21(3)32)16-17-27-29(19)30(22-10-6-4-7-11-22,23-12-8-5-9-13-23)25-15-14-24(33-20(2)31)18-28(25)35-27/h4-18H,1-3H3 |
| InChIKey | DZRUYNGYKRPVNF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|