About 2-benzoyl-4,6-dihydroxybenzaldehyde
2-benzoyl-4,6-dihydroxybenzaldehyde (PubChem CID 21197183) has the molecular formula C14H10O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-benzoyl-4,6-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 2-benzoyl-4,6-dihydroxybenzaldehyde |
| PubChem CID | 21197183 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-benzoyl-4,6-dihydroxybenzaldehyde |
| SMILES | O=Cc1c(O)cc(O)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H10O4/c15-8-12-11(6-10(16)7-13(12)17)14(18)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | DACWQNLNOKVCAQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-benzoyl-4,6-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyl-4,6-dihydroxybenzaldehyde?
The IUPAC name of 2-benzoyl-4,6-dihydroxybenzaldehyde (CID 21197183) is 2-benzoyl-4,6-dihydroxybenzaldehyde.
What is the SMILES notation for 2-benzoyl-4,6-dihydroxybenzaldehyde?
The canonical SMILES for 2-benzoyl-4,6-dihydroxybenzaldehyde is O=Cc1c(O)cc(O)cc1C(=O)c1ccccc1.
What is the InChIKey of 2-benzoyl-4,6-dihydroxybenzaldehyde?
The InChIKey is DACWQNLNOKVCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4/c15-8-12-11(6-10(16)7-13(12)17)14(18)9-4-2-1-3-5-9/h1-8,16-17H.
What are the key properties of 2-benzoyl-4,6-dihydroxybenzaldehyde?
2-benzoyl-4,6-dihydroxybenzaldehyde has a molecular weight of 242.23 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyl-4,6-dihydroxybenzaldehyde is sourced from PubChem (CID 21197183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).