C17H26O4 — CID 21199217
4-hydroxy-2-[[4-methoxy-3-(2-methylbutan-2-yl)phenyl]methyl]butanoic acid (PubChem CID 21199217) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4-hydroxy-2-[[4-methoxy-3-(2-methylbutan-2-yl)phenyl]methyl]butanoic acid.
| Compound Name | 4-hydroxy-2-[[4-methoxy-3-(2-methylbutan-2-yl)phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 21199217 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4-hydroxy-2-[[4-methoxy-3-(2-methylbutan-2-yl)phenyl]methyl]butanoic acid |
| SMILES | CCC(C)(C)c1cc(CC(CCO)C(=O)O)ccc1OC |
| InChI | InChI=1S/C17H26O4/c1-5-17(2,3)14-11-12(6-7-15(14)21-4)10-13(8-9-18)16(19)20/h6-7,11,13,18H,5,8-10H2,1-4H3,(H,19,20) |
| InChIKey | KLQCZZDOIYTJLF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |