C21H19Cl4NO5 — CID 21205272
(4-acetyl-5-methyl-2-propan-2-ylphenyl) N-[5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate (PubChem CID 21205272) has the molecular formula C21H19Cl4NO5 and a molecular weight of 507.20 g/mol. Its IUPAC name is (4-acetyl-5-methyl-2-propan-2-ylphenyl) N-[5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate.
| Compound Name | (4-acetyl-5-methyl-2-propan-2-ylphenyl) N-[5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate |
|---|---|
| PubChem CID | 21205272 |
| Molecular Formula | C21H19Cl4NO5 |
| Molecular Weight | 507.20 g/mol |
| Exact Mass | 505.00 |
| IUPAC Name | (4-acetyl-5-methyl-2-propan-2-ylphenyl) N-[5-chloro-2-(trichloromethyl)-1,3-benzodioxol-2-yl]carbamate |
| SMILES | CC(=O)c1cc(C(C)C)c(OC(=O)NC2(C(Cl)(Cl)Cl)Oc3ccc(Cl)cc3O2)cc1C |
| InChI | InChI=1S/C21H19Cl4NO5/c1-10(2)14-9-15(12(4)27)11(3)7-17(14)29-19(28)26-21(20(23,24)25)30-16-6-5-13(22)8-18(16)31-21/h5-10H,1-4H3,(H,26,28) |
| InChIKey | WXONJUFYZSZXLN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.20 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|