C10H10N6O2 — CID 21214173
4-amino-N'-[[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 21214173) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-amino-N'-[[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 21214173 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-amino-N'-[[(E)-3-(furan-2-yl)prop-2-enylidene]amino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\N=C/C=C/c1ccco1)c1nonc1N |
| InChI | InChI=1S/C10H10N6O2/c11-9(8-10(12)16-18-15-8)14-13-5-1-3-7-4-2-6-17-7/h1-6H,(H2,11,14)(H2,12,16)/b3-1+,13-5? |
| InChIKey | UZSVPZVTZRXXFL-ZQGBXITQSA-N |
| XLogP | 0.65 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|