C20H13ClF3N5O5S — CID 2123202
5-[4-carbamoyl-5-[[4-(trifluoromethoxy)benzoyl]carbamothioylamino]pyrazol-1-yl]-2-chlorobenzoic acid (PubChem CID 2123202) has the molecular formula C20H13ClF3N5O5S and a molecular weight of 527.87 g/mol. Its IUPAC name is 5-[4-carbamoyl-5-[[4-(trifluoromethoxy)benzoyl]carbamothioylamino]pyrazol-1-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[4-carbamoyl-5-[[4-(trifluoromethoxy)benzoyl]carbamothioylamino]pyrazol-1-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 2123202 |
| Molecular Formula | C20H13ClF3N5O5S |
| Molecular Weight | 527.87 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 5-[4-carbamoyl-5-[[4-(trifluoromethoxy)benzoyl]carbamothioylamino]pyrazol-1-yl]-2-chlorobenzoic acid |
| SMILES | NC(=O)c1cnn(-c2ccc(Cl)c(C(=O)O)c2)c1NC(=S)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H13ClF3N5O5S/c21-14-6-3-10(7-12(14)18(32)33)29-16(13(8-26-29)15(25)30)27-19(35)28-17(31)9-1-4-11(5-2-9)34-20(22,23)24/h1-8H,(H2,25,30)(H,32,33)(H2,27,28,31,35) |
| InChIKey | KEKTWICUNAQVMP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|