C20H13ClN5O6S- — CID 2100900
5-[5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-carbamoylpyrazol-1-yl]-2-chlorobenzoate (PubChem CID 2100900) has the molecular formula C20H13ClN5O6S- and a molecular weight of 486.87 g/mol. Its IUPAC name is 5-[5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-carbamoylpyrazol-1-yl]-2-chlorobenzoate.
| Compound Name | 5-[5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-carbamoylpyrazol-1-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 2100900 |
| Molecular Formula | C20H13ClN5O6S- |
| Molecular Weight | 486.87 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | 5-[5-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-carbamoylpyrazol-1-yl]-2-chlorobenzoate |
| SMILES | NC(=O)c1cnn(-c2ccc(Cl)c(C(=O)[O-])c2)c1NC(=S)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14ClN5O6S/c21-13-3-2-10(6-11(13)19(29)30)26-17(12(7-23-26)16(22)27)24-20(33)25-18(28)9-1-4-14-15(5-9)32-8-31-14/h1-7H,8H2,(H2,22,27)(H,29,30)(H2,24,25,28,33)/p-1 |
| InChIKey | YKQWDYHXIQIUPG-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.87 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|