C13H5Cl2F3N6 — CID 21233909
2-azido-4,5-dichloro-6-[4-(trifluoromethyl)anilino]pyridine-3-carbonitrile (PubChem CID 21233909) has the molecular formula C13H5Cl2F3N6 and a molecular weight of 373.13 g/mol. Its IUPAC name is 2-azido-4,5-dichloro-6-[4-(trifluoromethyl)anilino]pyridine-3-carbonitrile.
| Compound Name | 2-azido-4,5-dichloro-6-[4-(trifluoromethyl)anilino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 21233909 |
| Molecular Formula | C13H5Cl2F3N6 |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-azido-4,5-dichloro-6-[4-(trifluoromethyl)anilino]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N=[N+]=[N-])nc(Nc2ccc(C(F)(F)F)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl2F3N6/c14-9-8(5-19)11(23-24-20)22-12(10(9)15)21-7-3-1-6(2-4-7)13(16,17)18/h1-4H,(H,21,22) |
| InChIKey | LAPNEPBZJIESLH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|