C14H18N3O2S+ — CID 21233966
4,6,6-trimethyl-2-methylsulfanyl-3-(3-nitrophenyl)-1H-pyrimidin-3-ium (PubChem CID 21233966) has the molecular formula C14H18N3O2S+ and a molecular weight of 292.38 g/mol. Its IUPAC name is 4,6,6-trimethyl-2-methylsulfanyl-3-(3-nitrophenyl)-1H-pyrimidin-3-ium.
| Compound Name | 4,6,6-trimethyl-2-methylsulfanyl-3-(3-nitrophenyl)-1H-pyrimidin-3-ium |
|---|---|
| PubChem CID | 21233966 |
| Molecular Formula | C14H18N3O2S+ |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4,6,6-trimethyl-2-methylsulfanyl-3-(3-nitrophenyl)-1H-pyrimidin-3-ium |
| SMILES | CSC1=[N+](c2cccc([N+](=O)[O-])c2)C(C)=CC(C)(C)N1 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-9-14(2,3)15-13(20-4)16(10)11-6-5-7-12(8-11)17(18)19/h5-9H,1-4H3/p+1 |
| InChIKey | WHNYQDUXPVHBHH-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|