C18H17FN2O2 — CID 23433644
8-fluoro-2,2,4-trimethyl-6-(3-nitrophenyl)-1H-quinoline (PubChem CID 23433644) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 8-fluoro-2,2,4-trimethyl-6-(3-nitrophenyl)-1H-quinoline.
| Compound Name | 8-fluoro-2,2,4-trimethyl-6-(3-nitrophenyl)-1H-quinoline |
|---|---|
| PubChem CID | 23433644 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 8-fluoro-2,2,4-trimethyl-6-(3-nitrophenyl)-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2c(F)cc(-c3cccc([N+](=O)[O-])c3)cc21 |
| InChI | InChI=1S/C18H17FN2O2/c1-11-10-18(2,3)20-17-15(11)8-13(9-16(17)19)12-5-4-6-14(7-12)21(22)23/h4-10,20H,1-3H3 |
| InChIKey | IUAGOAGQKFUZKX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|