C24H21BrN2O — CID 21243248
2-[4-(1H-indol-3-yl)butyl]indeno[2,1-c]pyridin-2-ium-9-one bromide (PubChem CID 21243248) has the molecular formula C24H21BrN2O and a molecular weight of 433.35 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-yl)butyl]indeno[2,1-c]pyridin-2-ium-9-one bromide.
| Compound Name | 2-[4-(1H-indol-3-yl)butyl]indeno[2,1-c]pyridin-2-ium-9-one bromide |
|---|---|
| PubChem CID | 21243248 |
| Molecular Formula | C24H21BrN2O |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[4-(1H-indol-3-yl)butyl]indeno[2,1-c]pyridin-2-ium-9-one bromide |
| SMILES | O=C1c2ccccc2-c2cc[n+](CCCCc3c[nH]c4ccccc34)cc21.[Br-] |
| InChI | InChI=1S/C24H20N2O.BrH/c27-24-21-10-2-1-9-19(21)20-12-14-26(16-22(20)24)13-6-5-7-17-15-25-23-11-4-3-8-18(17)23;/h1-4,8-12,14-16H,5-7,13H2;1H |
| InChIKey | NQHICGJIRSZSIC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|