C13H14N2O6S — CID 21256278
4-(2,5-dioxopyrrol-1-yl)-2,5-dimethoxy-N-methylbenzenesulfonamide (PubChem CID 21256278) has the molecular formula C13H14N2O6S and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-2,5-dimethoxy-N-methylbenzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-2,5-dimethoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 21256278 |
| Molecular Formula | C13H14N2O6S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-2,5-dimethoxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(OC)c(N2C(=O)C=CC2=O)cc1OC |
| InChI | InChI=1S/C13H14N2O6S/c1-14-22(18,19)11-7-9(20-2)8(6-10(11)21-3)15-12(16)4-5-13(15)17/h4-7,14H,1-3H3 |
| InChIKey | CHNWJIYUXWHAOU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|