C15H15ClN2OS — CID 21271420
2-(2-chloroethyl)-4-methyl-2,3-dihydropyrido[4,3-h][1,4]benzoxazepine-5-thione (PubChem CID 21271420) has the molecular formula C15H15ClN2OS and a molecular weight of 306.82 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-methyl-2,3-dihydropyrido[4,3-h][1,4]benzoxazepine-5-thione.
| Compound Name | 2-(2-chloroethyl)-4-methyl-2,3-dihydropyrido[4,3-h][1,4]benzoxazepine-5-thione |
|---|---|
| PubChem CID | 21271420 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(2-chloroethyl)-4-methyl-2,3-dihydropyrido[4,3-h][1,4]benzoxazepine-5-thione |
| SMILES | CN1CC(CCCl)Oc2cc3cnccc3cc2C1=S |
| InChI | InChI=1S/C15H15ClN2OS/c1-18-9-12(2-4-16)19-14-7-11-8-17-5-3-10(11)6-13(14)15(18)20/h3,5-8,12H,2,4,9H2,1H3 |
| InChIKey | KHOBNRMYMHBDBQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|