C13H14Cl3N3O2S — CID 21275646
5-cyclopropyl-4-(4-methoxyphenyl)-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one (PubChem CID 21275646) has the molecular formula C13H14Cl3N3O2S and a molecular weight of 382.70 g/mol. Its IUPAC name is 5-cyclopropyl-4-(4-methoxyphenyl)-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one.
| Compound Name | 5-cyclopropyl-4-(4-methoxyphenyl)-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 21275646 |
| Molecular Formula | C13H14Cl3N3O2S |
| Molecular Weight | 382.70 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 5-cyclopropyl-4-(4-methoxyphenyl)-2-(trichloromethylsulfanyl)-1,2,4-triazolidin-3-one |
| SMILES | COc1ccc(N2C(=O)N(SC(Cl)(Cl)Cl)NC2C2CC2)cc1 |
| InChI | InChI=1S/C13H14Cl3N3O2S/c1-21-10-6-4-9(5-7-10)18-11(8-2-3-8)17-19(12(18)20)22-13(14,15)16/h4-8,11,17H,2-3H2,1H3 |
| InChIKey | ZFEFHWHVHXFYLB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|