C16H31NO — CID 21279920
5-(2-aminopropan-2-yl)-2,4-dimethylundec-1-en-3-one (PubChem CID 21279920) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 5-(2-aminopropan-2-yl)-2,4-dimethylundec-1-en-3-one.
| Compound Name | 5-(2-aminopropan-2-yl)-2,4-dimethylundec-1-en-3-one |
|---|---|
| PubChem CID | 21279920 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 5-(2-aminopropan-2-yl)-2,4-dimethylundec-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)C(CCCCCC)C(C)(C)N |
| InChI | InChI=1S/C16H31NO/c1-7-8-9-10-11-14(16(5,6)17)13(4)15(18)12(2)3/h13-14H,2,7-11,17H2,1,3-6H3 |
| InChIKey | LNUNHPAJYWKFIN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|