C11H17F3N6S3 — CID 21298700
1-methyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]thiourea (PubChem CID 21298700) has the molecular formula C11H17F3N6S3 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-methyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-methyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 21298700 |
| Molecular Formula | C11H17F3N6S3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 1-methyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]thiourea |
| SMILES | CNC(=S)NCCSCc1csc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H17F3N6S3/c1-16-9(21)17-2-3-22-4-7-5-23-10(19-7)20-8(15)18-6-11(12,13)14/h5H,2-4,6H2,1H3,(H2,16,17,21)(H3,15,18,19,20) |
| InChIKey | HUOZJAFTBGFNIX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|