C9H15F2N5S2 — CID 21298745
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2-difluoroethyl)guanidine (PubChem CID 21298745) has the molecular formula C9H15F2N5S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2-difluoroethyl)guanidine.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2-difluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298745 |
| Molecular Formula | C9H15F2N5S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2-difluoroethyl)guanidine |
| SMILES | NCCSCc1csc(N/C(N)=N/CC(F)F)n1 |
| InChI | InChI=1S/C9H15F2N5S2/c10-7(11)3-14-8(13)16-9-15-6(5-18-9)4-17-2-1-12/h5,7H,1-4,12H2,(H3,13,14,15,16) |
| InChIKey | RWOBHIDGGMYGDW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|