C23H30F3N3O3 — CID 21302855
9-(2-methoxyethyl)-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 21302855) has the molecular formula C23H30F3N3O3 and a molecular weight of 453.51 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-(2-methoxyethyl)-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 21302855 |
| Molecular Formula | C23H30F3N3O3 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 9-(2-methoxyethyl)-N-[5-[(2,2,2-trifluoroacetyl)amino]pentyl]-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | COCCn1c2c(c3cc(C(=O)NCCCCCNC(=O)C(F)(F)F)ccc31)CCCC2 |
| InChI | InChI=1S/C23H30F3N3O3/c1-32-14-13-29-19-8-4-3-7-17(19)18-15-16(9-10-20(18)29)21(30)27-11-5-2-6-12-28-22(31)23(24,25)26/h9-10,15H,2-8,11-14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | MWGJFRQBTMKIPF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|