C4H3Cl2O2- — CID 21311713
3,3-dichloro-2-methylprop-2-enoate (PubChem CID 21311713) has the molecular formula C4H3Cl2O2- and a molecular weight of 153.97 g/mol. Its IUPAC name is 3,3-dichloro-2-methylprop-2-enoate.
| Compound Name | 3,3-dichloro-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21311713 |
| Molecular Formula | C4H3Cl2O2- |
| Molecular Weight | 153.97 g/mol |
| Exact Mass | 152.95 |
| IUPAC Name | 3,3-dichloro-2-methylprop-2-enoate |
| SMILES | CC(C(=O)[O-])=C(Cl)Cl |
| InChI | InChI=1S/C4H4Cl2O2/c1-2(3(5)6)4(7)8/h1H3,(H,7,8)/p-1 |
| InChIKey | JNQCCAPUTUZTTP-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.97 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|